C25H25N5O5 — CID 5019543
(2-nitrophenyl) 4-[6-methyl-3-(pyridin-3-ylmethylcarbamoyl)-2-pyridinyl]piperidine-1-carboxylate (PubChem CID 5019543) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is (2-nitrophenyl) 4-[6-methyl-3-(pyridin-3-ylmethylcarbamoyl)-2-pyridinyl]piperidine-1-carboxylate.
| Compound Name | (2-nitrophenyl) 4-[6-methyl-3-(pyridin-3-ylmethylcarbamoyl)-2-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 5019543 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2-nitrophenyl) 4-[6-methyl-3-(pyridin-3-ylmethylcarbamoyl)-2-pyridinyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)NCc2cccnc2)c(C2CCN(C(=O)Oc3ccccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C25H25N5O5/c1-17-8-9-20(24(31)27-16-18-5-4-12-26-15-18)23(28-17)19-10-13-29(14-11-19)25(32)35-22-7-3-2-6-21(22)30(33)34/h2-9,12,15,19H,10-11,13-14,16H2,1H3,(H,27,31) |
| InChIKey | BNSSETDZKGYKRH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|