C21H32N2O2S2 — CID 5020903
1-[4-(thiophene-2-carbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]nonan-1-one (PubChem CID 5020903) has the molecular formula C21H32N2O2S2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1-[4-(thiophene-2-carbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]nonan-1-one.
| Compound Name | 1-[4-(thiophene-2-carbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]nonan-1-one |
|---|---|
| PubChem CID | 5020903 |
| Molecular Formula | C21H32N2O2S2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[4-(thiophene-2-carbonyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCC2(CC1)SCCN2C(=O)c1cccs1 |
| InChI | InChI=1S/C21H32N2O2S2/c1-2-3-4-5-6-7-10-19(24)22-13-11-21(12-14-22)23(15-17-27-21)20(25)18-9-8-16-26-18/h8-9,16H,2-7,10-15,17H2,1H3 |
| InChIKey | LDSMMQICJITSLR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|