C22H31N3O4S — CID 4543860
1-[4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]octan-1-one (PubChem CID 4543860) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 1-[4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]octan-1-one.
| Compound Name | 1-[4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]octan-1-one |
|---|---|
| PubChem CID | 4543860 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCC2(CC1)SCCN2C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H31N3O4S/c1-2-3-4-5-6-10-20(26)23-13-11-22(12-14-23)24(15-16-30-22)21(27)18-8-7-9-19(17-18)25(28)29/h7-9,17H,2-6,10-16H2,1H3 |
| InChIKey | HJRAYFRXRITJOO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|