C17H22N4O4S — CID 3877111
N,N-dimethyl-4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 3877111) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N,N-dimethyl-4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 3877111 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N,N-dimethyl-4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CN(C)C(=O)N1CCC2(CC1)SCCN2C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-18(2)16(23)19-8-6-17(7-9-19)20(10-11-26-17)15(22)13-4-3-5-14(12-13)21(24)25/h3-5,12H,6-11H2,1-2H3 |
| InChIKey | RWUIAMHOAUKQLV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|