C24H23N3O5S2 — CID 3566941
(8-naphthalen-2-ylsulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl)-(3-nitrophenyl)methanone (PubChem CID 3566941) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is (8-naphthalen-2-ylsulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl)-(3-nitrophenyl)methanone.
| Compound Name | (8-naphthalen-2-ylsulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3566941 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (8-naphthalen-2-ylsulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl)-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCSC12CCN(S(=O)(=O)c1ccc3ccccc3c1)CC2 |
| InChI | InChI=1S/C24H23N3O5S2/c28-23(20-6-3-7-21(16-20)27(29)30)26-14-15-33-24(26)10-12-25(13-11-24)34(31,32)22-9-8-18-4-1-2-5-19(18)17-22/h1-9,16-17H,10-15H2 |
| InChIKey | VCCVBBHNEYNODS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|