C21H23N3O6S2 — CID 3484505
[8-(4-methoxyphenyl)sulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-nitrophenyl)methanone (PubChem CID 3484505) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is [8-(4-methoxyphenyl)sulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [8-(4-methoxyphenyl)sulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3484505 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [8-(4-methoxyphenyl)sulfonyl-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCC3(CC2)SCCN3C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H23N3O6S2/c1-30-18-5-7-19(8-6-18)32(28,29)22-11-9-21(10-12-22)23(13-14-31-21)20(25)16-3-2-4-17(15-16)24(26)27/h2-8,15H,9-14H2,1H3 |
| InChIKey | ICHFBEQNOMANOP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|