C22H22ClN3O5S — CID 42773603
[8-(2-chloro-4-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-methoxyphenyl)methanone (PubChem CID 42773603) has the molecular formula C22H22ClN3O5S and a molecular weight of 475.95 g/mol. Its IUPAC name is [8-(2-chloro-4-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [8-(2-chloro-4-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42773603 |
| Molecular Formula | C22H22ClN3O5S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [8-(2-chloro-4-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCSC23CCN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)CC3)c1 |
| InChI | InChI=1S/C22H22ClN3O5S/c1-31-17-4-2-3-15(13-17)20(27)25-11-12-32-22(25)7-9-24(10-8-22)21(28)18-6-5-16(26(29)30)14-19(18)23/h2-6,13-14H,7-12H2,1H3 |
| InChIKey | JAVOFRMBLDUCFF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|