C27H25N3O4S — CID 4984034
[4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-phenylphenyl)methanone (PubChem CID 4984034) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is [4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 4984034 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [4-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]-(4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCC2(CC1)SCCN2C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25N3O4S/c31-25(22-11-9-21(10-12-22)20-5-2-1-3-6-20)28-15-13-27(14-16-28)29(17-18-35-27)26(32)23-7-4-8-24(19-23)30(33)34/h1-12,19H,13-18H2 |
| InChIKey | HXVUPISYBFSAHI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|