C14H18O — CID 5022606
3,4,4-trimethyl-1-phenylpent-1-yn-3-ol (PubChem CID 5022606) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-phenylpent-1-yn-3-ol.
| Compound Name | 3,4,4-trimethyl-1-phenylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 5022606 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3,4,4-trimethyl-1-phenylpent-1-yn-3-ol |
| SMILES | CC(C)(C)C(C)(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-13(2,3)14(4,15)11-10-12-8-6-5-7-9-12/h5-9,15H,1-4H3 |
| InChIKey | FNOTWYZKEJTYEO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|