C18H15Cl2NO2 — CID 5027845
2-[2-(2,4-dichlorophenyl)-7-ethyl-1H-indol-3-yl]acetic acid (PubChem CID 5027845) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-7-ethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-7-ethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5027845 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-7-ethyl-1H-indol-3-yl]acetic acid |
| SMILES | CCc1cccc2c(CC(=O)O)c(-c3ccc(Cl)cc3Cl)[nH]c12 |
| InChI | InChI=1S/C18H15Cl2NO2/c1-2-10-4-3-5-12-14(9-16(22)23)18(21-17(10)12)13-7-6-11(19)8-15(13)20/h3-8,21H,2,9H2,1H3,(H,22,23) |
| InChIKey | FVQASXORZWAXSC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |