C18H14N4O2 — CID 5028639
7-methyl-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]imidazole (PubChem CID 5028639) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 7-methyl-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]imidazole.
| Compound Name | 7-methyl-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]imidazole |
|---|---|
| PubChem CID | 5028639 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 7-methyl-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]imidazole |
| SMILES | Cn1c(-c2cccc([N+](=O)[O-])c2)cn2cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H14N4O2/c1-20-17(14-8-5-9-15(10-14)22(23)24)12-21-11-16(19-18(20)21)13-6-3-2-4-7-13/h2-12H,1H3 |
| InChIKey | OKSJCVRRWDNNPQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|