C18H20N2O3 — CID 5028859
[2-(cyclopropylamino)-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 5028859) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5028859 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)OCC(=O)NC2CC2)c1C |
| InChI | InChI=1S/C18H20N2O3/c1-3-14-11(2)17(13-6-4-5-7-15(13)20-14)18(22)23-10-16(21)19-12-8-9-12/h4-7,12H,3,8-10H2,1-2H3,(H,19,21) |
| InChIKey | FLPFNDVDPNETFX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |