C37H36N4O6 — CID 5029040
N,N'-bis[1,3-bis(4-methoxyphenyl)prop-2-enylideneamino]propanediamide (PubChem CID 5029040) has the molecular formula C37H36N4O6 and a molecular weight of 632.72 g/mol. Its IUPAC name is N,N'-bis[1,3-bis(4-methoxyphenyl)prop-2-enylideneamino]propanediamide.
| Compound Name | N,N'-bis[1,3-bis(4-methoxyphenyl)prop-2-enylideneamino]propanediamide |
|---|---|
| PubChem CID | 5029040 |
| Molecular Formula | C37H36N4O6 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | N,N'-bis[1,3-bis(4-methoxyphenyl)prop-2-enylideneamino]propanediamide |
| SMILES | COc1ccc(C=CC(=NNC(=O)CC(=O)NN=C(C=Cc2ccc(OC)cc2)c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H36N4O6/c1-44-30-15-5-26(6-16-30)9-23-34(28-11-19-32(46-3)20-12-28)38-40-36(42)25-37(43)41-39-35(29-13-21-33(47-4)22-14-29)24-10-27-7-17-31(45-2)18-8-27/h5-24H,25H2,1-4H3,(H,40,42)(H,41,43) |
| InChIKey | GSIHQKHTEPMITA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|