C17H15N5O2S — CID 503150
1-benzyl-2,2-dioxo-6-phenyl-5H-imidazo[4,5-c][1,2,6]thiadiazin-4-amine (PubChem CID 503150) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-benzyl-2,2-dioxo-6-phenyl-5H-imidazo[4,5-c][1,2,6]thiadiazin-4-amine.
| Compound Name | 1-benzyl-2,2-dioxo-6-phenyl-5H-imidazo[4,5-c][1,2,6]thiadiazin-4-amine |
|---|---|
| PubChem CID | 503150 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-benzyl-2,2-dioxo-6-phenyl-5H-imidazo[4,5-c][1,2,6]thiadiazin-4-amine |
| SMILES | NC1=NS(=O)(=O)N(Cc2ccccc2)c2nc(-c3ccccc3)[nH]c21 |
| InChI | InChI=1S/C17H15N5O2S/c18-15-14-17(20-16(19-14)13-9-5-2-6-10-13)22(25(23,24)21-15)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,18,21)(H,19,20) |
| InChIKey | AIOAPRDQNULXOA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |