C23H20Cl2N4O2 — CID 5032493
2-(2,4-dichlorophenoxy)-N-[2-(4-ethylphenyl)benzotriazol-5-yl]propanamide (PubChem CID 5032493) has the molecular formula C23H20Cl2N4O2 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(4-ethylphenyl)benzotriazol-5-yl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(4-ethylphenyl)benzotriazol-5-yl]propanamide |
|---|---|
| PubChem CID | 5032493 |
| Molecular Formula | C23H20Cl2N4O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(4-ethylphenyl)benzotriazol-5-yl]propanamide |
| SMILES | CCc1ccc(-n2nc3ccc(NC(=O)C(C)Oc4ccc(Cl)cc4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C23H20Cl2N4O2/c1-3-15-4-8-18(9-5-15)29-27-20-10-7-17(13-21(20)28-29)26-23(30)14(2)31-22-11-6-16(24)12-19(22)25/h4-14H,3H2,1-2H3,(H,26,30) |
| InChIKey | SLPVROQNQJXUGD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |