C9H15N3O3 — CID 503409
4-amino-1-[(3S)-3,5-dihydroxypentyl]pyrimidin-2-one (PubChem CID 503409) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-amino-1-[(3S)-3,5-dihydroxypentyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3S)-3,5-dihydroxypentyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 503409 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 4-amino-1-[(3S)-3,5-dihydroxypentyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC[C@H](O)CCO)c(=O)n1 |
| InChI | InChI=1S/C9H15N3O3/c10-8-2-5-12(9(15)11-8)4-1-7(14)3-6-13/h2,5,7,13-14H,1,3-4,6H2,(H2,10,11,15)/t7-/m0/s1 |
| InChIKey | QOKXRDKHZOBSCT-ZETCQYMHSA-N |
| XLogP | -1.04 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |