C23H20ClNO2 — CID 5038246
N-[(4-chlorophenyl)methyl]-3-(3-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 5038246) has the molecular formula C23H20ClNO2 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(3-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5038246 |
| Molecular Formula | C23H20ClNO2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1cccc(C=C(C(=O)NCc2ccc(Cl)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20ClNO2/c1-27-21-9-5-6-18(14-21)15-22(19-7-3-2-4-8-19)23(26)25-16-17-10-12-20(24)13-11-17/h2-15H,16H2,1H3,(H,25,26) |
| InChIKey | JYOAMPMUECWWOQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|