C29H37N3O3S — CID 5038593
N-benzyl-2-[(2,3-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5038593) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is N-benzyl-2-[(2,3-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(2,3-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5038593 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-benzyl-2-[(2,3-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C29H37N3O3S/c1-5-35-18-10-17-31(29(34)30-27-14-9-11-22(2)24(27)4)21-28(33)32(19-25-12-7-6-8-13-25)20-26-16-15-23(3)36-26/h6-9,11-16H,5,10,17-21H2,1-4H3,(H,30,34) |
| InChIKey | GGBBBLKPLBDESQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|