C28H35N3O4S — CID 5225686
N-benzyl-2-[(2-ethoxyphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5225686) has the molecular formula C28H35N3O4S and a molecular weight of 509.67 g/mol. Its IUPAC name is N-benzyl-2-[(2-ethoxyphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(2-ethoxyphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5225686 |
| Molecular Formula | C28H35N3O4S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | N-benzyl-2-[(2-ethoxyphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOc1ccccc1NC(=O)N(CCCOC)CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1 |
| InChI | InChI=1S/C28H35N3O4S/c1-4-35-26-14-9-8-13-25(26)29-28(33)30(17-10-18-34-3)21-27(32)31(19-23-11-6-5-7-12-23)20-24-16-15-22(2)36-24/h5-9,11-16H,4,10,17-21H2,1-3H3,(H,29,33) |
| InChIKey | HSZKUPFRLMGBFN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|