C23H30N6O3 — CID 5039827
7-(3-ethoxypropyl)-5-(4-ethylpiperazine-1-carbonyl)-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 5039827) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 7-(3-ethoxypropyl)-5-(4-ethylpiperazine-1-carbonyl)-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 7-(3-ethoxypropyl)-5-(4-ethylpiperazine-1-carbonyl)-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 5039827 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 7-(3-ethoxypropyl)-5-(4-ethylpiperazine-1-carbonyl)-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1/c(C(=O)N2CCN(CC)CC2)cc2c(=O)n3ccccc3nc2n1CCCOCC |
| InChI | InChI=1S/C23H30N6O3/c1-3-26-11-13-27(14-12-26)22(30)17-16-18-21(29(20(17)24)10-7-15-32-4-2)25-19-8-5-6-9-28(19)23(18)31/h5-6,8-9,16,24H,3-4,7,10-15H2,1-2H3/b24-20- |
| InChIKey | NYTQYUGBPWEHIC-GFMRDNFCSA-N |
| XLogP | 1.33 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|