C25H25N5O5 — CID 3252991
ethyl 1-[7-(furan-2-ylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate (PubChem CID 3252991) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is ethyl 1-[7-(furan-2-ylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[7-(furan-2-ylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3252991 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl 1-[7-(furan-2-ylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate |
| SMILES | [H]/N=c1\c(C(=O)N2CCC(C(=O)OCC)CC2)cc2c(=O)n3ccccc3nc2n1Cc1ccco1 |
| InChI | InChI=1S/C25H25N5O5/c1-2-34-25(33)16-8-11-28(12-9-16)23(31)18-14-19-22(27-20-7-3-4-10-29(20)24(19)32)30(21(18)26)15-17-6-5-13-35-17/h3-7,10,13-14,16,26H,2,8-9,11-12,15H2,1H3/b26-21+ |
| InChIKey | CIHHDFLYSZBXHP-YYADALCUSA-N |
| XLogP | 2.19 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|