C24H29N5O5 — CID 3649213
ethyl 1-[6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate (PubChem CID 3649213) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is ethyl 1-[6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3649213 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | ethyl 1-[6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]piperidine-4-carboxylate |
| SMILES | [H]/N=c1/c(C(=O)N2CCC(C(=O)OCC)CC2)cc2c(=O)n3cccc(C)c3nc2n1CCOC |
| InChI | InChI=1S/C24H29N5O5/c1-4-34-24(32)16-7-10-27(11-8-16)22(30)17-14-18-21(28(19(17)25)12-13-33-3)26-20-15(2)6-5-9-29(20)23(18)31/h5-6,9,14,16,25H,4,7-8,10-13H2,1-3H3/b25-19- |
| InChIKey | DCFZLNYIHQHLIP-PLRJNAJWSA-N |
| XLogP | 1.50 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|