C23H29N5O3 — CID 3975097
5-(3,5-dimethylpiperidine-1-carbonyl)-6-imino-7-(2-methoxyethyl)-11-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 3975097) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidine-1-carbonyl)-6-imino-7-(2-methoxyethyl)-11-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 5-(3,5-dimethylpiperidine-1-carbonyl)-6-imino-7-(2-methoxyethyl)-11-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 3975097 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 5-(3,5-dimethylpiperidine-1-carbonyl)-6-imino-7-(2-methoxyethyl)-11-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1/c(C(=O)N2CC(C)CC(C)C2)cc2c(=O)n3cccc(C)c3nc2n1CCOC |
| InChI | InChI=1S/C23H29N5O3/c1-14-10-15(2)13-26(12-14)22(29)17-11-18-21(27(19(17)24)8-9-31-4)25-20-16(3)6-5-7-28(20)23(18)30/h5-7,11,14-15,24H,8-10,12-13H2,1-4H3/b24-19- |
| InChIKey | RXLBBUYMIQFPGM-CLCOLTQESA-N |
| XLogP | 2.20 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|