C27H29N5O2 — CID 18822570
6-imino-11-methyl-7-[(4-methylphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 18822570) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 6-imino-11-methyl-7-[(4-methylphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 6-imino-11-methyl-7-[(4-methylphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 18822570 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 6-imino-11-methyl-7-[(4-methylphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1\c(C(=O)N2CCC(C)CC2)cc2c(=O)n3cccc(C)c3nc2n1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C27H29N5O2/c1-17-6-8-20(9-7-17)16-32-23(28)21(26(33)30-13-10-18(2)11-14-30)15-22-25(32)29-24-19(3)5-4-12-31(24)27(22)34/h4-9,12,15,18,28H,10-11,13-14,16H2,1-3H3/b28-23+ |
| InChIKey | SNADFSCZENLGPY-WEMUOSSPSA-N |
| XLogP | 3.67 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|