C17H23N3O3 — CID 5041101
4-butoxy-N-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]benzamide (PubChem CID 5041101) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-butoxy-N-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]benzamide.
| Compound Name | 4-butoxy-N-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 5041101 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-butoxy-N-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2noc(CCC)n2)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-5-11-22-14-9-7-13(8-10-14)17(21)18-12-15-19-16(6-4-2)23-20-15/h7-10H,3-6,11-12H2,1-2H3,(H,18,21) |
| InChIKey | INEPGJIHRYXEHC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|