C12H23NS2 — CID 504549
3-(2,6-dimethylheptan-4-yl)-1,3-thiazolidine-2-thione (PubChem CID 504549) has the molecular formula C12H23NS2 and a molecular weight of 245.46 g/mol. Its IUPAC name is 3-(2,6-dimethylheptan-4-yl)-1,3-thiazolidine-2-thione.
| Compound Name | 3-(2,6-dimethylheptan-4-yl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 504549 |
| Molecular Formula | C12H23NS2 |
| Molecular Weight | 245.46 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-(2,6-dimethylheptan-4-yl)-1,3-thiazolidine-2-thione |
| SMILES | CC(C)CC(CC(C)C)N1CCSC1=S |
| InChI | InChI=1S/C12H23NS2/c1-9(2)7-11(8-10(3)4)13-5-6-15-12(13)14/h9-11H,5-8H2,1-4H3 |
| InChIKey | VJJNSEOYHNCDLI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|