C10H10FN5O2 — CID 5047155
4-amino-N'-[(3-fluorophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 5047155) has the molecular formula C10H10FN5O2 and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-amino-N'-[(3-fluorophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(3-fluorophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 5047155 |
| Molecular Formula | C10H10FN5O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-amino-N'-[(3-fluorophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC(=NOCc1cccc(F)c1)c1nonc1N |
| InChI | InChI=1S/C10H10FN5O2/c11-7-3-1-2-6(4-7)5-17-15-9(12)8-10(13)16-18-14-8/h1-4H,5H2,(H2,12,15)(H2,13,16) |
| InChIKey | GOWNFTXNGKFDHP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|