C10H8FN5O3 — CID 5343092
[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate (PubChem CID 5343092) has the molecular formula C10H8FN5O3 and a molecular weight of 265.20 g/mol. Its IUPAC name is [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate.
| Compound Name | [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate |
|---|---|
| PubChem CID | 5343092 |
| Molecular Formula | C10H8FN5O3 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate |
| SMILES | N/C(=N/OC(=O)c1ccccc1F)c1nonc1N |
| InChI | InChI=1S/C10H8FN5O3/c11-6-4-2-1-3-5(6)10(17)18-15-8(12)7-9(13)16-19-14-7/h1-4H,(H2,12,15)(H2,13,16) |
| InChIKey | FSLATCHICDGBRD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|