C12H13N5O3 — CID 6383896
[(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] benzoate (PubChem CID 6383896) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] benzoate.
| Compound Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] benzoate |
|---|---|
| PubChem CID | 6383896 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] benzoate |
| SMILES | CN(C)/C(=N\OC(=O)c1ccccc1)c1nonc1N |
| InChI | InChI=1S/C12H13N5O3/c1-17(2)11(9-10(13)15-20-14-9)16-19-12(18)8-6-4-3-5-7-8/h3-7H,1-2H3,(H2,13,15)/b16-11- |
| InChIKey | HAQPCCJRYUHQFI-WJDWOHSUSA-N |
| XLogP | 0.73 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|