C14H15N5O4 — CID 6368557
[(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-morpholin-4-ylmethylidene]amino] benzoate (PubChem CID 6368557) has the molecular formula C14H15N5O4 and a molecular weight of 317.30 g/mol. Its IUPAC name is [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-morpholin-4-ylmethylidene]amino] benzoate.
| Compound Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-morpholin-4-ylmethylidene]amino] benzoate |
|---|---|
| PubChem CID | 6368557 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-morpholin-4-ylmethylidene]amino] benzoate |
| SMILES | Nc1nonc1/C(=N/OC(=O)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C14H15N5O4/c15-12-11(16-23-17-12)13(19-6-8-21-9-7-19)18-22-14(20)10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,15,17)/b18-13- |
| InChIKey | KYHQVTYEQPMOBE-AQTBWJFISA-N |
| XLogP | 0.50 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|