C19H26Cl2N2O — CID 5047635
1,1-dicyclohexyl-3-(2,4-dichlorophenyl)urea (PubChem CID 5047635) has the molecular formula C19H26Cl2N2O and a molecular weight of 369.34 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1,1-dicyclohexyl-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 5047635 |
| Molecular Formula | C19H26Cl2N2O |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1,1-dicyclohexyl-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H26Cl2N2O/c20-14-11-12-18(17(21)13-14)22-19(24)23(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h11-13,15-16H,1-10H2,(H,22,24) |
| InChIKey | OQWFZQCVKCLLOC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |