C30H34N4O4 — CID 5048
N-(2-aminophenyl)-6-[5-hydroxy-1,3-dioxo-6-(piperidin-1-ylmethyl)benzo[de]isoquinolin-2-yl]hexanamide (PubChem CID 5048) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[5-hydroxy-1,3-dioxo-6-(piperidin-1-ylmethyl)benzo[de]isoquinolin-2-yl]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[5-hydroxy-1,3-dioxo-6-(piperidin-1-ylmethyl)benzo[de]isoquinolin-2-yl]hexanamide |
|---|---|
| PubChem CID | 5048 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-(2-aminophenyl)-6-[5-hydroxy-1,3-dioxo-6-(piperidin-1-ylmethyl)benzo[de]isoquinolin-2-yl]hexanamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCN1C(=O)c2cccc3c(CN4CCCCC4)c(O)cc(c23)C1=O |
| InChI | InChI=1S/C30H34N4O4/c31-24-12-4-5-13-25(24)32-27(36)14-3-1-8-17-34-29(37)21-11-9-10-20-23(19-33-15-6-2-7-16-33)26(35)18-22(28(20)21)30(34)38/h4-5,9-13,18,35H,1-3,6-8,14-17,19,31H2,(H,32,36) |
| InChIKey | ICTBILHZNDIZIF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|