C21H20N2O2 — CID 166635773
5-[2-(dimethylamino)ethyl]-8-hydroxybenzo[c]phenanthridin-6-one (PubChem CID 166635773) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyl]-8-hydroxybenzo[c]phenanthridin-6-one.
| Compound Name | 5-[2-(dimethylamino)ethyl]-8-hydroxybenzo[c]phenanthridin-6-one |
|---|---|
| PubChem CID | 166635773 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 5-[2-(dimethylamino)ethyl]-8-hydroxybenzo[c]phenanthridin-6-one |
| SMILES | CN(C)CCn1c(=O)c2cc(O)ccc2c2ccc3ccccc3c21 |
| InChI | InChI=1S/C21H20N2O2/c1-22(2)11-12-23-20-16-6-4-3-5-14(16)7-9-18(20)17-10-8-15(24)13-19(17)21(23)25/h3-10,13,24H,11-12H2,1-2H3 |
| InChIKey | IAWGECLFNBJXKG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|