C19H19NO4 — CID 504882
2,4-dioxo-4-[N-(3-phenylpropyl)anilino]butanoic acid (PubChem CID 504882) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2,4-dioxo-4-[N-(3-phenylpropyl)anilino]butanoic acid.
| Compound Name | 2,4-dioxo-4-[N-(3-phenylpropyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 504882 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2,4-dioxo-4-[N-(3-phenylpropyl)anilino]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c21-17(19(23)24)14-18(22)20(16-11-5-2-6-12-16)13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12H,7,10,13-14H2,(H,23,24) |
| InChIKey | AJPGRESCXYCNCZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|