C16H19F2NO — CID 5049786
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-difluorobenzamide (PubChem CID 5049786) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 5049786 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-difluorobenzamide |
| SMILES | CC(NC(=O)c1ccc(F)cc1F)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H19F2NO/c1-9(14-7-10-2-3-11(14)6-10)19-16(20)13-5-4-12(17)8-15(13)18/h4-5,8-11,14H,2-3,6-7H2,1H3,(H,19,20) |
| InChIKey | QHQBZSGMQZRVHL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |