C21H20N4O2S — CID 5049858
2-(1-butyl-3-methylbenzimidazol-2-ylidene)-2-(1,1-dioxo-1,2-benzothiazol-3-yl)acetonitrile (PubChem CID 5049858) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-(1-butyl-3-methylbenzimidazol-2-ylidene)-2-(1,1-dioxo-1,2-benzothiazol-3-yl)acetonitrile.
| Compound Name | 2-(1-butyl-3-methylbenzimidazol-2-ylidene)-2-(1,1-dioxo-1,2-benzothiazol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 5049858 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(1-butyl-3-methylbenzimidazol-2-ylidene)-2-(1,1-dioxo-1,2-benzothiazol-3-yl)acetonitrile |
| SMILES | CCCCN1C(=C(C#N)C2=NS(=O)(=O)c3ccccc32)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H20N4O2S/c1-3-4-13-25-18-11-7-6-10-17(18)24(2)21(25)16(14-22)20-15-9-5-8-12-19(15)28(26,27)23-20/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | BNFUFVGHROWJHV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|