C29H23BrN4O3 — CID 5050515
2-amino-4-(4-bromophenyl)-1-(2-methyl-5-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5050515) has the molecular formula C29H23BrN4O3 and a molecular weight of 555.43 g/mol. Its IUPAC name is 2-amino-4-(4-bromophenyl)-1-(2-methyl-5-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(4-bromophenyl)-1-(2-methyl-5-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5050515 |
| Molecular Formula | C29H23BrN4O3 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 2-amino-4-(4-bromophenyl)-1-(2-methyl-5-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(N)=C(C#N)C(c2ccc(Br)cc2)C2=C1CC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C29H23BrN4O3/c1-17-7-12-22(34(36)37)15-24(17)33-25-13-20(18-5-3-2-4-6-18)14-26(35)28(25)27(23(16-31)29(33)32)19-8-10-21(30)11-9-19/h2-12,15,20,27H,13-14,32H2,1H3 |
| InChIKey | DWMOHTHGNNSHCO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|