C19H18N8 — CID 505525
4-[[4-amino-6-[(2,4,6-trimethylphenyl)diazenyl]-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 505525) has the molecular formula C19H18N8 and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-[[4-amino-6-[(2,4,6-trimethylphenyl)diazenyl]-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-amino-6-[(2,4,6-trimethylphenyl)diazenyl]-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 505525 |
| Molecular Formula | C19H18N8 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-[[4-amino-6-[(2,4,6-trimethylphenyl)diazenyl]-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(/N=N/c2nc(N)nc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C19H18N8/c1-11-8-12(2)16(13(3)9-11)26-27-19-24-17(21)23-18(25-19)22-15-6-4-14(10-20)5-7-15/h4-9H,1-3H3,(H3,21,22,23,24,25)/b27-26+ |
| InChIKey | LPMDQNIWAXYMHY-CYYJNZCTSA-N |
| XLogP | 4.41 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|