C20H13NO5 — CID 5056371
2-(4-methoxyphenyl)-4-[(4-oxochromen-3-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 5056371) has the molecular formula C20H13NO5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-[(4-oxochromen-3-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-methoxyphenyl)-4-[(4-oxochromen-3-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5056371 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-[(4-oxochromen-3-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=NC(=Cc3coc4ccccc4c3=O)C(=O)O2)cc1 |
| InChI | InChI=1S/C20H13NO5/c1-24-14-8-6-12(7-9-14)19-21-16(20(23)26-19)10-13-11-25-17-5-3-2-4-15(17)18(13)22/h2-11H,1H3 |
| InChIKey | NBRMSXCUBVIYET-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|