C20H19N3OS — CID 5056700
N-[(4-ethoxyphenyl)methylideneamino]-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine (PubChem CID 5056700) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methylideneamino]-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine.
| Compound Name | N-[(4-ethoxyphenyl)methylideneamino]-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 5056700 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[(4-ethoxyphenyl)methylideneamino]-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
| SMILES | CCOc1ccc(C=NNc2nc3c(s2)CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C20H19N3OS/c1-2-24-16-10-7-14(8-11-16)13-21-23-20-22-19-17-6-4-3-5-15(17)9-12-18(19)25-20/h3-8,10-11,13H,2,9,12H2,1H3,(H,22,23) |
| InChIKey | XRTDXWOUWIVJKS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|