C29H33Cl2N3O2 — CID 5059274
2-[3-butan-2-yl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-1,4-benzodiazepin-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 5059274) has the molecular formula C29H33Cl2N3O2 and a molecular weight of 526.51 g/mol. Its IUPAC name is 2-[3-butan-2-yl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-1,4-benzodiazepin-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[3-butan-2-yl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-1,4-benzodiazepin-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 5059274 |
| Molecular Formula | C29H33Cl2N3O2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[3-butan-2-yl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-1,4-benzodiazepin-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | CCC(C)C1N=C(c2ccccc2Cl)c2cc(Cl)ccc2N(CC(=O)NCCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C29H33Cl2N3O2/c1-3-19(2)27-29(36)34(18-26(35)32-16-15-20-9-5-4-6-10-20)25-14-13-21(30)17-23(25)28(33-27)22-11-7-8-12-24(22)31/h7-9,11-14,17,19,27H,3-6,10,15-16,18H2,1-2H3,(H,32,35) |
| InChIKey | SXPABKBDBGSNBV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|