C19H16N2O3S2 — CID 5060191
3,5-dimethoxy-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide (PubChem CID 5060191) has the molecular formula C19H16N2O3S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 5060191 |
| Molecular Formula | C19H16N2O3S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 3,5-dimethoxy-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2nc3c(s2)CSc2ccccc2-3)c1 |
| InChI | InChI=1S/C19H16N2O3S2/c1-23-12-7-11(8-13(9-12)24-2)18(22)21-19-20-17-14-5-3-4-6-15(14)25-10-16(17)26-19/h3-9H,10H2,1-2H3,(H,20,21,22) |
| InChIKey | DBLRXVYHMFOLNY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |