C17H11FN2OS2 — CID 3290409
3-fluoro-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide (PubChem CID 3290409) has the molecular formula C17H11FN2OS2 and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-fluoro-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide.
| Compound Name | 3-fluoro-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3290409 |
| Molecular Formula | C17H11FN2OS2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3-fluoro-N-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2c(s1)CSc1ccccc1-2)c1cccc(F)c1 |
| InChI | InChI=1S/C17H11FN2OS2/c18-11-5-3-4-10(8-11)16(21)20-17-19-15-12-6-1-2-7-13(12)22-9-14(15)23-17/h1-8H,9H2,(H,19,20,21) |
| InChIKey | RMRXCKGGGYWOQV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |