C16H15N3O2S — CID 5061557
ethyl 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyliminomethyl)benzoate (PubChem CID 5061557) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is ethyl 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyliminomethyl)benzoate.
| Compound Name | ethyl 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyliminomethyl)benzoate |
|---|---|
| PubChem CID | 5061557 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyliminomethyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/C=N/Cc2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-2-21-15(20)13-5-3-12(4-6-13)9-17-10-14-11-19-7-8-22-16(19)18-14/h3-9,11H,2,10H2,1H3/b17-9+ |
| InChIKey | YUGNDWHHXFQRRG-RQZCQDPDSA-N |
| XLogP | 3.19 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|