C17H12Cl2N4O — CID 5063416
N,2-bis(4-chlorophenyl)-3-cyano-3,4-dihydropyrazole-5-carboxamide (PubChem CID 5063416) has the molecular formula C17H12Cl2N4O and a molecular weight of 359.22 g/mol. Its IUPAC name is N,2-bis(4-chlorophenyl)-3-cyano-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N,2-bis(4-chlorophenyl)-3-cyano-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5063416 |
| Molecular Formula | C17H12Cl2N4O |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N,2-bis(4-chlorophenyl)-3-cyano-3,4-dihydropyrazole-5-carboxamide |
| SMILES | N#CC1CC(C(=O)Nc2ccc(Cl)cc2)=NN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2N4O/c18-11-1-5-13(6-2-11)21-17(24)16-9-15(10-20)23(22-16)14-7-3-12(19)4-8-14/h1-8,15H,9H2,(H,21,24) |
| InChIKey | VXIWLXBWAUUOCH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |