C26H21ClN4O3S — CID 506371
1-(4-chloro-1H-indol-3-yl)-2-[4-(4-pyridin-2-yl-2-sulfanylbenzoyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 506371) has the molecular formula C26H21ClN4O3S and a molecular weight of 505.00 g/mol. Its IUPAC name is 1-(4-chloro-1H-indol-3-yl)-2-[4-(4-pyridin-2-yl-2-sulfanylbenzoyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-chloro-1H-indol-3-yl)-2-[4-(4-pyridin-2-yl-2-sulfanylbenzoyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 506371 |
| Molecular Formula | C26H21ClN4O3S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 1-(4-chloro-1H-indol-3-yl)-2-[4-(4-pyridin-2-yl-2-sulfanylbenzoyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccc(-c3ccccn3)cc2S)CC1)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C26H21ClN4O3S/c27-19-4-3-6-21-23(19)18(15-29-21)24(32)26(34)31-12-10-30(11-13-31)25(33)17-8-7-16(14-22(17)35)20-5-1-2-9-28-20/h1-9,14-15,29,35H,10-13H2 |
| InChIKey | UYUWWXDBHQCPHT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|