About 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one
5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 5065326) has the molecular formula C18H15N3O3S
and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 5065326 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2csc3ncn(-n4cccc4)c(=O)c23)cc1OC |
| InChI | InChI=1S/C18H15N3O3S/c1-23-14-6-5-12(9-15(14)24-2)13-10-25-17-16(13)18(22)21(11-19-17)20-7-3-4-8-20/h3-11H,1-2H3 |
| InChIKey | FOYKGSPBDSOUFY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one (CID 5065326) is 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one is COc1ccc(-c2csc3ncn(-n4cccc4)c(=O)c23)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is FOYKGSPBDSOUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3S/c1-23-14-6-5-12(9-15(14)24-2)13-10-25-17-16(13)18(22)21(11-19-17)20-7-3-4-8-20/h3-11H,1-2H3.
What are the key properties of 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one?
5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 353.40 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-3-pyrrol-1-ylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 5065326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).