C15H9Cl4NOS — CID 5068538
1-(3-methylphenyl)-3-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]prop-2-en-1-one (PubChem CID 5068538) has the molecular formula C15H9Cl4NOS and a molecular weight of 393.12 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]prop-2-en-1-one.
| Compound Name | 1-(3-methylphenyl)-3-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 5068538 |
| Molecular Formula | C15H9Cl4NOS |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]prop-2-en-1-one |
| SMILES | Cc1cccc(C(=O)C=CSc2c(Cl)c(Cl)nc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H9Cl4NOS/c1-8-3-2-4-9(7-8)10(21)5-6-22-13-11(16)14(18)20-15(19)12(13)17/h2-7H,1H3 |
| InChIKey | UNFREHSLINKHMR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|