C15H13BrN2OS — CID 2801899
1-(3-bromophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylprop-2-en-1-one (PubChem CID 2801899) has the molecular formula C15H13BrN2OS and a molecular weight of 349.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylprop-2-en-1-one.
| Compound Name | 1-(3-bromophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 2801899 |
| Molecular Formula | C15H13BrN2OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 1-(3-bromophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylprop-2-en-1-one |
| SMILES | Cc1cc(C)nc(SC=CC(=O)c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H13BrN2OS/c1-10-8-11(2)18-15(17-10)20-7-6-14(19)12-4-3-5-13(16)9-12/h3-9H,1-2H3 |
| InChIKey | VKKNXGXXFFNEPS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|