C16H10BrNO2S — CID 4075683
3-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-bromophenyl)prop-2-en-1-one (PubChem CID 4075683) has the molecular formula C16H10BrNO2S and a molecular weight of 360.23 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-bromophenyl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-bromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4075683 |
| Molecular Formula | C16H10BrNO2S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-bromophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CSc1nc2ccccc2o1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H10BrNO2S/c17-12-5-3-4-11(10-12)14(19)8-9-21-16-18-13-6-1-2-7-15(13)20-16/h1-10H |
| InChIKey | RKBMUGZBUGFBDU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|